M-4365 G1
It is produced by the strain of Micromonospora capillate MCRL 0940. M-4365 G1 is mainly resistant to Gram-positive bacteria and mycoplasma, and cross-resistance with other macrolide antibiotics. And it also has a certain anti-Gram-negative bacteria activity.
Supplier | BOC Sciences |
---|---|
Product # | BBF-03634 |
Pricing | Inquire |
Molecular Weight | 551.75 |
Molecular Formula | C31H53NO7 |
Canonical SMILES | CCC1CC(C(=O)C=CC(=CC(C(OC(=O)CC(C(C1OC2C(C(CC(O2)C)N(C)C)O)C)O)CC)C)C)C |