N6-Benzoyl-7-deaza-2'-deoxyadenosine
N6-Benzoyl-7-deaza-2'-deoxyadenosine, a remarkable compound extensively employed in the biomedicine sector, showcases immense promise for diverse disease treatments due to its distinctive structure. Concrete investigations have rendered compelling evidence regarding its efficacy in targeting select enzymes implicated in DNA replication and repair. Consequently, this compound holds immense potential in the development of groundbreaking pharmaceuticals targeting cancer, viral infections, and genetic disorders. With such multifarious applications, N6-Benzoyl-7-deaza-2'-deoxyadenosine stands as an irreplaceable asset within the realm of biomedical research and drug exploration.
| Supplier | BOC Sciences |
|---|---|
| Product # | 95261-09-9 |
| Pricing | Inquire |
| Cas | 95261-09-9 |
| Molecular Weight | 354.37 |
| Molecular Formula | C18H18N4O4 |
| Canonical SMILES | C1C(C(OC1N2C=CC3=C(N=CN=C32)NC(=O)C4=CC=CC=C4)CO)O |