4-Benzoylbenzoic acid
4-Benzoylbenzoic acid (CAS# 611-95-0) is a reagent that is used in the synthesis of BzATP Triethylammonium Salt, which is a selective P2X purinergic agonist. It is more potent than ATP at homodimeric P2X7 receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | 611-95-0 |
| Pricing | Inquire |
| Cas | 611-95-0 |
| Molecular Weight | 226.23 |
| Molecular Formula | C14H10O3 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)C(=O)O |