Pterisolic acid B
Pterisolic acid B is extracted from the herbs of Pteris semipinnata. It is the analogue of natural product J19-1, which has cytoprotective effect against cisplatin-induced cytotoxicity in HKC cells. It is also an effective Nrf2 activator.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP1752 |
| Pricing | Inquire |
| Cas | 1401419-86-0 |
| Molecular Weight | 330.42 |
| Molecular Formula | C20H26O4 |
| Canonical SMILES | CC12CCCC(C1C(CC34C2=CCC(C3)C(=C)C4=O)O)(C)C(=O)O |