Auristatin F
Auristatin F, a synthetic analog of dolastatin 10, is a cytotoxic tubulin modifier with potent and selective antitumor activity. It is an MMAF analog and cytotoxin in Antibody-drug conjugates.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-00045 |
| Pricing | 25 mg/unit USD $1099 |
| Cas | 163768-50-1 |
| Molecular Weight | 745.99 |
| Molecular Formula | C40H67N5O8 |
| Canonical SMILES | CCC(C)C(C(CC(=O)N1CCCC1C(C(C)C(=O)NC(CC2=CC=CC=C2)C(=O)O)OC)OC)N(C)C(=O)C(C(C)C)NC(=O)C(C(C)C)N(C)C |