6,8-Difluoro-4-methylumbelliferyl b-D-glucopyranoside
6,8-Difluoro-4-methylumbelliferyl b-D-glucopyranoside is a vital tool used in the biomedical industry. It acts as a fluorescent substrate, commonly employed to detect and measure the activity of glucosidases. This substrate finds applications in research related to various diseases, such as Gaucher's disease, Pompe disease, and other lysosomal storage disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 351009-26-2 |
| Pricing | Inquire |
| Cas | 351009-26-2 |
| Molecular Weight | 374.29 |
| Molecular Formula | C16H16F2O8 |
| Canonical SMILES | CC1=CC(=O)OC2=C(C(=C(C=C12)F)OC3C(C(C(C(O3)CO)O)O)O)F |