Methyl 2-acetamido-2-deoxy-b-D-galactopyranoside
Methyl 2-acetamido-2-deoxy-b-D-galactopyranoside, an indispensable compound in the biomedical field, exhibits promising capabilities in combating bacterial infections through targeted suppression of bacterial cell wall synthesis. Its exceptional inhibitory properties render it an invaluable ingredient in antibiotics and antimicrobial formulations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3055-46-7 |
| Pricing | Inquire |
| Cas | 3055-46-7 |
| Molecular Weight | 235.24 |
| Molecular Formula | C9H17NO6 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC)CO)O)O |