Valdecoxib Impurity D
Valdecoxib Impurity D is a metabolite of Valdecoxib. Valdecoxib is a non-steroidal anti-inflammatory drug (NSAID) used for the treatment of osteoarthritis, rheumatoid arthritis, etc. Valdecoxib exhibits a selectively inhibitory effect of cyclooxygenase-2.
| Supplier | BOC Sciences |
|---|---|
| Product # | 181696-35-5 |
| Pricing | Inquire |
| Cas | 181696-35-5 |
| Molecular Weight | 315.35 |
| Molecular Formula | C16H13NO4S |
| Canonical SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C3=CC=C(C=C3)S(=O)(=O)O |