2-Fluoro-4-biphenylylboronic acid
2-Fluoro-4-biphenylylboronic acid is a boronic acid derivative commonly used in biomedical research. It is a versatile reagent in Suzuki cross-coupling reactions utilized in the synthesis of several pharmaceutical drugs designed to treat cardiovascular diseases and certain types of cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 178305-99-2 |
| Pricing | Inquire |
| Cas | 178305-99-2 |
| Molecular Weight | 216.02 |
| Molecular Formula | C12H10O2BF |
| Canonical SMILES | B(C1=CC(=C(C=C1)C2=CC=CC=C2)F)(O)O |