4-Isopropoxyphenylboronic Acid
Reactant for: Microwave-mediated click-chemistry synthesis of glyco-porphyrin derivatives with in vitro photo-cytotoxicity for application in photodynamic therapy; Palladium-catalyzed oxidative cross-coupling reactions; Ruthenium-catalyzed hydrogenation reactions; Stereoselective rhodium-catalyzed arylation; Palladium acetate catalyzed C-glycosidation.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB010919 |
| Pricing | Inquire |
| Cas | 153624-46-5 |
| Molecular Weight | 180.01 |
| Molecular Formula | C9H13O3B |
| Canonical SMILES | B(C1=CC=C(C=C1)OC(C)C)(O)O |