Adenosine-5'-O-diphosphoribose phosphate
Adenosine-5'-O-diphosphoribose phosphate (ADRP) is a highly significant biomolecule that participates in a myriad of intricate cellular processes. Its paramount importance stems from being an essential substrate for a class of enzymes known as poly(ADP-ribose) polymerases (PARPs), which undertake the arduous tasks of DNA repair and modification. Remarkably, ADRP assumes a pivotal role in combating diseases associated with DNA damage, most notably cancer. Furthermore, it assumes an indispensable function in orchestrating the intricate mechanisms governing cellular metabolism and the highly intricate machinery of mitochondrial function.
| Supplier | BOC Sciences |
|---|---|
| Product # | 53595-18-9 |
| Pricing | Inquire |
| Cas | 53595-18-9 |
| Molecular Weight | 639.30 |
| Molecular Formula | C15H24N5O17P3 |
| Canonical SMILES | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OCC(C(C(C=O)O)O)O)O)OP(=O)(O)O)N |