17-AG
An orally bioavailable formulation of the ansamycin derivative 17-amino-17-demethoxygeldanamycin (17-AG) with potential antineoplastic activity. Oral Hsp90 inhibitor IPI-493 binds to and inhibits Hsp90, which may result the in growth inhibition in sensitive tumor cell populations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 64202-81-9 |
| Pricing | Inquire |
| Cas | 64202-81-9 |
| Molecular Weight | 545.62 |
| Molecular Formula | C28H39N3O8 |
| Canonical SMILES | CC1CC(C(C(C=C(C(C(C=CC=C(C(=O)NC2=CC(=O)C(=C(C1)C2=O)N)C)OC)OC(=O)N)C)C)O)OC |