9-Amino-1,2,3,4-tetrahydroacridin-1-ol-[d3] Maleate
9-Amino-1,2,3,4-tetrahydroacridin-1-ol-[d3] Maleate is the labelled analogue of 9-Amino-1,2,3,4-tetrahydroacridin-1-ol Maleate, which is an impurity of Tacrine. Tacrine is an effective cholinesterase inhibitor and could probably be active in studies of Alzheimers's disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-013008 |
| Pricing | Inquire |
| Cas | 1219806-48-0 |
| Molecular Weight | 333.36 |
| Molecular Formula | C17H15D3N2O5 |
| Canonical SMILES | C1CC(C2=C(C3=CC=CC=C3N=C2C1)N)O.C(=CC(=O)O)C(=O)O |