D-Glucose-6-phosphate disodium salt
D-Glucose-6-phosphate disodium salt, a crucial biochemical intermediate involved in glucose metabolism, has multifaceted functions ranging from synthesizing glycogen or generating NADPH for cellular biosynthesis via the pentose phosphate pathway. Its use extends beyond being a mere metabolite to offerings as diverse as being a key component in enzymatic assays to measure glucose-6-phosphate dehydrogenase activity. Furthermore, its central role in metabolic maladies, including type 2 diabetes, cannot be understated.
Supplier | BOC Sciences |
---|---|
Product # | 3671-99-6 |
Pricing | Inquire |
Cas | 3671-99-6 |
Molecular Weight | 304.10 |
Molecular Formula | C6H11Na2O9P |
Canonical SMILES | C(C(C(C(C(C=O)O)O)O)O)OP(=O)([O-])[O-].[Na+].[Na+] |