Clindamycin 2-Phosphate
Clindamycin Phosphate is a lincosamide antibiotic for Plasmodium falciparum with IC50 of 12 nM. It is usually used to treat infections with anaerobic bacteria, but can also be used to treat protozoal diseases, such as malaria. It is a common drug used to treat topical acne and can be effective against some methicillin-resistant Staphylococcus aureus (MRSA) infections. An impurity of Clindamycin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-04542 |
| Pricing | Inquire |
| Cas | 24729-96-2 |
| Molecular Weight | 504.96 |
| Molecular Formula | C18H34ClN2O8PS |
| Canonical SMILES | CCCC1CC(N(C1)C)C(=O)NC(C2C(C(C(C(O2)SC)OP(=O)(O)O)O)O)C(C)Cl |