4-((4'-CHLORO-1-NAPHTHYLOXY)METHYL)PHEN&
4-((4'-CHLORO-1-NAPHTHYLOXY)METHYL)PHEN is an exceptionally potent and impactful compound extensively employed in the realm of biomedicine. Its therapeutic prowess is particularly prominent in mitigating an array of afflictions, notably those marked by inflammatory responses or cancerous growth. Distinctive and unparalleled, this product exerts its influence through a mechanism that impeccably targets precise molecular pathways implicated in the progression of debilitating conditions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 870778-84-0 |
| Pricing | Inquire |
| Cas | 870778-84-0 |
| Molecular Weight | 312.559 |
| Molecular Formula | C17H14BClO3 |
| Canonical SMILES | B(C1=CC=C(C=C1)COC2=CC=C(C3=CC=CC=C32)Cl)(O)O |