Des-5'-chloro-4-fluorobenzyl Mosapride
Des-5'-chloro-4-fluorobenzyl Mosapride is an intermediate of Mosapride, which is a selective agonist of 5-HT4 receptor, could be used as an astroprokinetic agent. It is also found to be a 5-HT3 receptor antagonist.
| Supplier | BOC Sciences |
|---|---|
| Product # | 170799-30-1 |
| Pricing | Inquire |
| Cas | 170799-30-1 |
| Molecular Weight | 279.33 |
| Molecular Formula | C14H21N3O3 |
| Canonical SMILES | CCOC1=C(C=CC(=C1)N)C(=O)NCC2CNCCO2 |