2'-Deoxy-5'-O-DMT-N2-methylguanosine 3'-CE phosphoramidite
2'-Deoxy-5'-O-DMT-N2-methylguanosine 3'-CE phosphoramidite is a crucial component in the biomedical field, finding its application in synthesizing nucleic acids. Its primary utility lies in the synthesis of altered RNA, particularly in the introduction of methylguanosine modifications. This exceptional product empowers researchers to delve into the intricate interplay between methylguanosine modifications and the structure and function of RNA.
| Supplier | BOC Sciences |
|---|---|
| Product # | 808132-80-1 |
| Pricing | Inquire |
| Cas | 808132-80-1 |
| Molecular Weight | 783.85 |
| Molecular Formula | C41H50N7O7P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C5N=C(NC6=O)NC |