Nonapeptide-1
Nonapeptide-1 is a skin-lightening peptide that prevents melanin synthesis and unwanted pigmentation. It is used as an additive in whitening or spot corrective products. Nonapeptide-1 is a biomimetic peptide that is a good match for the MC1 receptor on melanocytes and thus acts as an antagonist to melanocytotropic hormone, competitively binding to the MC1 receptor and preventing further activation of tyrosinase to produce melanin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-010784 |
| Pricing | Inquire |
| Cas | 158563-45-2 |
| Molecular Weight | 1206.523 |
| Molecular Formula | C61H87N15O9S |
| Canonical SMILES | CC(C)C(C(=O)N)NC(=O)C1CCCN1C(=O)C(CCCCN)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(CC3=CNC4=CC=CC=C43)NC(=O)C(CCCN=C(N)N)NC(=O)C(CC5=CC=CC=C5)NC(=O)C6CCCN6C(=O)C(CCSC)N |