2-Amino-b-D-arabinofurano[1,2;4,5]oxazoline
2-Amino-b-D-arabinofurano[1,2;4,5]oxazoline, an essential compound employed in the realm of biomedical research, assumes a pivotal role owing to its distinct structure. Its eminent significance lies in the pursuit and advancement of innovative pharmaceuticals aimed at a diverse range of ailments. From probing potential antiviral agents to delving into uncharted therapeutic avenues for combating cancer, its applications encompass a vast scientific spectrum.
| Supplier | BOC Sciences |
|---|---|
| Product # | 27963-98-0 |
| Pricing | Inquire |
| Cas | 27963-98-0 |
| Molecular Weight | 174.15 |
| Molecular Formula | C6H10N2O4 |
| Canonical SMILES | C(C1C(C2C(O1)N=C(O2)N)O)O |