18:2 PE
18:2 PE, known as 1,2-dilinoleoylphosphatidylethanolamine, is a multifunctional phospholipid utilized in the biomedical sector with promising therapeutic implications for diverse pathologies such as oncological malignancies and neurodegenerative conditions. Its significance lies in facilitating the integrity and operability of cellular membranes, thus fostering optimal physiological homeostasis and cellular activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20707-71-5 |
| Pricing | Inquire |
| Cas | 20707-71-5 |
| Molecular Weight | 740.00 |
| Molecular Formula | C41H74NO8P |
| Canonical SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCCC=CCC=CCCCCC |