Phellodendrine chloride
Phellodendrine chloride can be found in the peel of Phellodendron amurense Rupr. Phellodendrine was effective in crescentic-type anti-GBM nephritis and the antinephritic mechanisms of this agent may be due to its ability to inhibit the proliferation or the migration of macrophages and cytotoxic T lymphocytes in the glomeruli.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2703-464407 |
| Pricing | Inquire |
| Cas | 104112-82-5 |
| Molecular Weight | 377.85 |
| Molecular Formula | C20H24NO4.Cl |
| Canonical SMILES | C[N+]12CCC3=CC(=C(C=C3C1CC4=CC(=C(C=C4C2)OC)O)O)OC.[Cl-] |