Malvidin 3-glucoside chloride
Malvidin 3-glucoside chloride is a potent compound offering a novel approach in studying oxidative stress-induced ailments. Functioning as an exemplary antioxidant, this exceptional compound shields delicate cellular structures from the detrimental impact of notorious free radicals while concurrently studying detrimental inflammatory responses.
| Supplier | BOC Sciences |
|---|---|
| Product # | 7228-78-6 |
| Pricing | Inquire |
| Cas | 7228-78-6 |
| Molecular Weight | 528.89 |
| Molecular Formula | C23H25O12Cl |
| Canonical SMILES | COC1=CC(=CC(=C1O)OC)C2=[O+]C3=CC(=CC(=C3C=C2OC4C(C(C(C(O4)CO)O)O)O)O)O.[Cl-] |