AS-99 free base
AS-99 is a potent and selective ASH1L histone methyltransferase inhibitor (IC50= 0.79 µM, Kd= 0.89 µM) with anti-leukemic activity. AS-99 blocks cell proliferation, induces apoptosis and differentiation, downregulates MLL fusion target genes, and reduces the leukemia burden in vivo.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2323623-93-2 |
| Pricing | Inquire |
| Cas | 2323623-93-2 |
| Molecular Weight | 593.68 |
| Molecular Formula | C27H30F3N5O3S2 |
| Canonical SMILES | CN1CC(C1)C(=O)NCC2=CC3=C(C=C2)C(=CN3C4CCN(CC4)S(=O)(=O)C(F)(F)F)C5=CC(=CC=C5)C(=S)N |