4-[5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl]morpholine
4-[5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl]morpholine plays a crucial role in the development of potential drugs for treating specific diseases. Its unique chemical structure enables targeted interactions with specific receptors or enzymes involved in diseases like cancer, inflammation, or neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 485799-04-0 |
| Pricing | Inquire |
| Cas | 485799-04-0 |
| Molecular Weight | 290.166 |
| Molecular Formula | C15H23BN2O3 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)N3CCOCC3 |