Benzoic acid-acyl-b-D-glucuronide
Benzoic acid-acyl-b-D-glucuronide is an integral metabolite and biomarker employed in biomedical research and pharmaceutical development assuming a vital function in benzoic acid's metabolism and detoxification, thus facilitating the research of numerous ailments associated with its buildup.
| Supplier | BOC Sciences |
|---|---|
| Product # | 19237-53-7 |
| Pricing | Inquire |
| Cas | 19237-53-7 |
| Molecular Weight | 298.25 |
| Molecular Formula | C13H14O8 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OC2C(C(C(C(O2)C(=O)O)O)O)O |