3-Bromo-2-isopropoxy-5-methylphenylboronic acid
3-Bromo-2-isopropoxy-5-methylphenylboronic acid is a profoundly versatile compound that renowned and widely exploited in the realm of biomedicine due to its remarkable potential in combating a plethora of maladies. Harnessing the inherent power of its boronic acid moiety, this versatile compound demonstrates a formidable ability to impede the catalytic activity of specific proteases that underlie the ominous onset of tumorigenesis and afflictions of the neurological realm.
| Supplier | BOC Sciences |
|---|---|
| Product # | 870718-01-7 |
| Pricing | Inquire |
| Cas | 870718-01-7 |
| Molecular Weight | 272.93 |
| Molecular Formula | C10H14BBrO3 |
| Canonical SMILES | B(C1=CC(=CC(=C1OC(C)C)Br)C)(O)O |