o-Phenylene phosphorochloridite
| Supplier | Alfa Chemistry |
|---|---|
| Product # | ACM1641403 |
| CAS # | 1641-40-3 |
| Pricing | Inquire |
| Synonyms | 1,3,2-Benzodioxaphosphole,2-chloro-; I14-46673; Chloro(1,2-phenylenedioxy)phosphine; ZINC8100880; 1641-40-3; InChI=1/C6H4ClO2P/c7-10-8-5-3-1-2-4-6(5)9-10/h1-4; FT-0611679; 2-Chloro-1,3,2-benzodioxaphosphole; Phosphorochloridous acid orthophenylene ester; ACMC-1C1BZ; |
| IUPAC Name | 2-chloro-1,3,2-benzodioxaphosphole; |
| EC Number | 216-690-3 |
| MolecularFormula | C6H4ClO2P; |
| MolecularWeight | 174.52g/mol |
| Application | Highly reactive cyclic phosphitylating reagent which provides fast coupling rates, and hydrolytic cleavage occurs more readily than with acyclic analogs |