5'-Thiol-Modifier C6
5'-Thiol-Modifier C6, a biomedical agent, serves as a transformative tool for DNA sequence modification, gear towards tailor-made treatment of neoplastic disorders, viral contagions, as well as genetic anomalies. By minimizing harm to healthy cells while directing medicines to diseased cells, its role in therapeutic regimes for cancer, viral infections, and genetics is eminent and valuable.
| Supplier | BOC Sciences |
|---|---|
| Product # | 116919-17-6 |
| Pricing | Inquire |
| Cas | 116919-17-6 |
| Molecular Weight | 576.78 |
| Molecular Formula | C34H45N2O2PS |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCCCCCSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)OCCC#N |