POTASSIUM β-STYRYLTRIFLUOROBORATE
Reactant for:• Suzuki-Miyaura cross-coupling• Enantioselective total synthesis of naseseazines A and B via regioselective Friedel-Crafts based arylative dimerization• Metal-free chlorodeboronation reactions• Preparation of aryl ketones via Lewis acid-catalyzed nucleophilic substitution• Preparation of Weinreb amides by palladium-catalyzed cross-coupling reactions
| Supplier | BOC Sciences |
|---|---|
| Product # | 201852-49-5 |
| Pricing | Inquire |
| Cas | 201852-49-5 |
| Molecular Weight | 210.05 |
| Molecular Formula | C8H7BF3K |
| Canonical SMILES | [B-](C=CC1=CC=CC=C1)(F)(F)F.[K+] |