N-Acetyl-D-glucosamine-1-phosphate disodium salt
N-Acetyl-D-glucosamine-1-phosphate disodium salt, an indispensable constituent within the biomedical field, exhibits profound significance. It finds application in the remediation of diverse ailments such as lysosomal storage disorders and glycogen storage diseases. Conspicuously, this product assumes a pivotal function in expediting metabolic pathways, modulating cellular activities, and promoting holistic cellular well-being.
| Supplier | BOC Sciences |
|---|---|
| Product # | 374726-40-6 |
| Pricing | Inquire |
| Cas | 374726-40-6 |
| Molecular Weight | 345.15 |
| Molecular Formula | C8H14NNa2O9P |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OP(=O)([O-])[O-])CO)O)O.[Na+].[Na+] |