N-Formyl-Met-Leu-Phe
Supplier | Creative Peptides |
---|---|
Product # | R1553 |
CAS # | 59880-97-6 |
Pricing | Inquire |
Synonyms | fMLP; N-Formyl-MLF |
MolecularFormula | C21H31N3O5S |
MolecularWeight | 437.55 |
Sequence |
|
Storage | -20°C |
ShippingCondition | Shipped at room temperature |
Explanation | N-Formyl-Met-Leu-Phe (fMLP; N-Formyl-MLF) is a chemotactic peptide and a specific ligand of N-formyl peptide receptor (FPR). N-Formyl-Met-Leu-Ph is reported to inhibit TNF-alpha secretion. |
InChI | InChI=1S/C21H31N3O5S/c1-14(2)11-17(23-19(26)16(22-13-25)9-10-30-3)20(27)24-18(21(28)29)12-15-7-5-4-6-8-15/h4-8,13-14,16-18H,9-12H2,1-3H3,(H,22,25)(H,23,26)(H,24,27)(H,28,29)/t16-,17-,18-/m0/s1 |
InChIKey | PRQROPMIIGLWRP-BZSNNMDCSA-N |
CanonicalSMILES | O=C(O)[C@@H](N([H])C([C@@H](N(C([C@@H](N(C=O)[H])CCSC)=O)[H])CC(C)C)=O)CC1=CC=CC=C1 |
Solubility | Soluble to 4.38 mg/ml in DMSO |
Purity | ≥98% |