D-(-)-threo-2-Amino-1-(4-nitrophenyl)-1,3-propanediol
The parent 4-nitrophenylpropylamine formed by the hydrolysis of the dichloroacetamide of chloramphenicol. It has no antibiotic activity but has played an integral role in the synthesis and SAR of new generation antibiotics, notably thiamphenicol and experimental analogues, bromamphenicol and methamphenicol.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-04166 |
| Pricing | Inquire |
| Cas | 716-61-0 |
| Molecular Weight | 212.20 |
| Molecular Formula | C9H12N2O4 |
| Canonical SMILES | C1=CC(=CC=C1C(C(CO)N)O)[N+](=O)[O-] |