Diclofenac-[d4] Sodium
Diclofenac-[d4] Sodium, is the labelled analogue of Diclofenac. Diclofenac is a non-selective COX inhibitor with IC50 of 0.5 μg/ml and 0.5 μg/ml for COX-1 and COX-2 in intact cells, respectively.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-007350 |
| Pricing | Inquire |
| Cas | 154523-54-3 |
| Molecular Weight | 322.16 |
| Molecular Formula | C14H6D4Cl2NO2 |
| Canonical SMILES | C1=CC=C(C(=C1)CC(=O)[O-])NC2=C(C=CC=C2Cl)Cl.[Na+] |