2-Formylphenyl 2-acetamido-2-deoxy-b-D-glucopyranoside
2-Formylphenyl 2-acetamido-2-deoxy-b-D-glucopyranoside, a multifaceted biomedical compound, showcases immense potential for therapeutic applications. Its versatility lends itself to combating an array of ailments, encompassing cancer and inflammation. This compound's exceptional architecture and intricately orchestrated mechanism of action instigate a novel avenue for targeted intervention in disease pathways, thus heralding uncharted prospects in pharmaceutical advancements and individualized medical treatments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 15430-78-1 |
| Pricing | Inquire |
| Cas | 15430-78-1 |
| Molecular Weight | 325.31 |
| Molecular Formula | C15H19NO7 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2=CC=CC=C2C=O)CO)O)O |