7-Deaza-2',3'-dideoxy-7-iodoguanosine
7-Deaza-2',3'-dideoxy-7-iodoguanosine, a compound of significant importance in the biomedical sector, possesses remarkable capacities to selectively combat various ailments, predominantly viral infections, through hindering viral replication. Its multifaceted antiviral properties pave the way for potential breakthroughs in viral infection treatment. Augmenting therapeutic outcomes in preclinical investigations, this substance exhibits immense promise when administered in conjunction with adjunctive pharmaceutical agents. Its application within research and development endeavors further underscores its significance within the biomedical realm.
Supplier | BOC Sciences |
---|---|
Product # | 114748-67-3 |
Pricing | Inquire |
Cas | 114748-67-3 |
Molecular Weight | 376.15 |
Molecular Formula | C11H13N4O3I |
Canonical SMILES | C1CC(OC1CO)N2C=C(C3=C2N=C(NC3=O)N)I |