7-deaza-GTP
7-Deaza-GTP, a modified nucleotide with versatile biomedical applications, has contributed significantly to the study of transcription. Its utility in various assays to examine RNA polymerases and its function as a substrate for RNA capping and labeling have been well-documented. Beyond this, the compound has been instrumental in advancing the research on RNA splicing and protein translation. Its multifaceted role in these crucial biological processes underscores its importance in the biomedical field and makes it a valuable research tool.
| Supplier | BOC Sciences |
|---|---|
| Product # | 181356-39-8 |
| Pricing | Inquire |
| Cas | 181356-39-8 |
| Molecular Weight | 522.19 |
| Molecular Formula | C11H17N4O14P3 |
| Canonical SMILES | C1=CN(C2=C1C(=O)NC(=N2)N)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O |