rel-(3S,4R,5R,6S)-5-Methoxy-4-[(2R,3R)-2-methyl-3-(3-methyl-2-buten-1-yl)-2-oxiranyl]-1-oxaspiro[2.5]octan-6-ol
rel-(3S,4R,5R,6S)-5-Methoxy-4-[(2R,3R)-2-methyl-3-(3-methyl-2-buten-1-yl)-2-oxiranyl]-1-oxaspiro[2.5]octan-6-ol is an innovative compound thriving in the biomedical industry exhibiting immense potential for targeting precise enzymes and receptors to study a diverse array of ailments like cancer, inflammation and neurological disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 35903-52-7 |
| Pricing | Inquire |
| Cas | 35903-52-7 |
| Molecular Weight | 282.38 |
| Molecular Formula | C16H26O4 |
| Canonical SMILES | OC1CCC2(OC2)C(C1OC)C3(OC3CC=C(C)C)C |