Somatostatin-28 (sheep)
Somatostatin-28 (sheep) is derived from posttranslational cleavage of prosomatostatin, which in turn is derived from a larger precursor, preprosomatostatin. S-28 is an octacosapeptide first isolated from the duodenum of pigs. Unlike S-14, S-28 increases amylase secretion, cellular cyclic GMP and Ca2+ outfluxes in the guinea pig pancreatic acini.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015200 |
| Pricing | Inquire |
| Cas | 73032-94-7 |
| Molecular Weight | 3148.56 |
| Molecular Formula | C137H207N41O39S3 |
| Canonical SMILES | CC(C1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(CSSCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CCCCN)CC2=CNC3=CC=CC=C32)CC4=CC=CC=C4)CC5=CC=CC=C5)CC(=O)N)CCCCN)NC(=O)CNC(=O)C(C)NC(=O)C(CCCCN)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCC(=O)O)NC(=O)C(CCCNC(=N)N)NC(=O)C6CCCN6C(=O)C(C)NC(=O)C(CCSC)NC(=O)C(C)NC(=O)C7CCCN7C(=O)C(CC(=O)N)NC(=O)C(CO)NC(=O)C(CC(=O)N)NC(=O)C(C)NC(=O)C(CO)N)C(=O)O)CO)C(C)O)CC8=CC=CC=C8)O |