tetrafluorosuccinic acid
Tetrafluorosuccinic acid is a powerful reagent widely used in the biomedical industry. It is employed in the synthesis of various pharmaceuticals and agrochemicals. Additionally, it plays a crucial role in the development and manufacturing of drugs used to treat respiratory diseases, cancer, and viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 377-38-8 |
| Pricing | Inquire |
| Cas | 377-38-8 |
| Molecular Weight | 190.0499 |
| Molecular Formula | C4H2F4O4 |
| Canonical SMILES | C(=O)(C(C(C(=O)O)(F)F)(F)F)O |