Maridomycin III
It is produced by the strain of Str. hygroscopicus B-5050. It's a macrolide antibiotic. It has the activity against gram-positive bacteria and mycoplasma. Serum dose not affect its antibacterial activity. It has the effect of protecting gram-positive bacterial infection mice, and the therapeutic dose is similar to styloleomycin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02302 |
| Pricing | Inquire |
| Cas | 35775-82-7 |
| Molecular Weight | 829.97 |
| Molecular Formula | C41H67NO16 |
| Canonical SMILES | CCC(=O)C1CC(=O)OC(CC2C(O2)C=CC(C(CC(C(C1OC)OC3C(C(C(C(O3)C)OC4CC(C(C(O4)C)OC(=O)CC)(C)O)N(C)C)O)CC=O)C)O)C |