Doxycycline EP Impurity F
Doxycycline EP Impurity F is an impurity of Doxycycline, which is a semisynthetic, broad-spectrum tetracycline antibiotic used in the treatment of infections caused by bacteria and certain parasites.
Supplier | BOC Sciences |
---|---|
Product # | B2694-470498 |
Pricing | Inquire |
Cas | 122861-53-4 |
Molecular Weight | 443.46 |
Molecular Formula | C23H25NO8 |
Canonical SMILES | O=C1C=2C(O)=CC=CC2C(C)C3C1=C(O)C4(O)C(=O)C(C(=O)C)=C(O)C(N(C)C)C4C3O |