α-D-Mannose-1-phosphate sodium salt
α-D-Mannose-1-phosphate sodium salt, a pivotal constituent widely utilized in the biomedical realm, unveils its profound therapeutic attributes. This distinctive product holds immense significance in combating a spectrum of inherited ailments encompassing glycogen storage diseases (GSDs) and disorders correlated with phosphomannomutase 2 (PMM2) deficiency.
| Supplier | BOC Sciences |
|---|---|
| Product # | 99749-54-9 |
| Pricing | Inquire |
| Cas | 99749-54-9 |
| Molecular Weight | 282.12 |
| Molecular Formula | C6H12NaO9P |
| Canonical SMILES | C(C1C(C(C(C(O1)OP(=O)(O)[O-])O)O)O)O.[Na+] |