Influenza A virus-IN-1
Influenza A virus-IN-1, a dihydropyrrolidone derivative, is a potent inhibitor against wide subtypes of influenza A virus (IAV) with IC50s of 3.11-7.13 μM. It effectively inhibits the replication of IAV and up-regulates the expression of key antiviral cytokines IFN-β and antiviral protein MxA.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2250313-14-3 |
| Pricing | Inquire |
| Cas | 2250313-14-3 |
| Molecular Weight | 534.45 |
| Molecular Formula | C27H20F6N2O3 |
| Canonical SMILES | CCOC(=O)C1=C(C(=O)N(C1C2=CC=CC=C2)C3=CC=C(C=C3)C(F)(F)F)NC4=CC=C(C=C4)C(F)(F)F |