Adenosine 3',5'-cyclic monophosphate sodium salt
Adenosine 3',5'-cyclic monophosphate sodium salt is an indispensable constituent within the realm of biomedical exploration, operating as an ancillary courier engendering intracellular signal transduction. Its pervasive application embraces a multifarious array of cellular proclivities, encompassing metabolic processes, genetic manifestation and neural transmission.
| Supplier | BOC Sciences |
|---|---|
| Product # | 37839-81-9 |
| Pricing | Inquire |
| Cas | 37839-81-9 |
| Molecular Weight | 351.19 |
| Molecular Formula | C10H11N5NaO6P |
| Canonical SMILES | C1C2C(C(C(O2)N3C=NC4=C(N=CN=C43)N)O)OP(=O)(O1)[O-].[Na+] |