N4-Benzoyl-2'-O-tert-butyldimethylsilyl-5'-O-DMT-cytidine
N4-Benzoyl-2'-O-tert-butyldimethylsilyl-5'-O-DMT-cytidine is a valuable compound extensively used in the biomedical industry acting as a key intermediate for the synthesis of nucleotides and nucleosides. This product finds application in the development of antiviral drugs targeting various diseases caused by viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 81256-87-3 |
| Pricing | Inquire |
| Cas | 81256-87-3 |
| Molecular Weight | 763.95 |
| Molecular Formula | C43H49N3O8Si |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OC1C(C(OC1N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O |