6-Methoxy-9-(2-C-methyl-beta-D-ribofuranosyl)purine
6-Methoxy-9-(2-C-methyl-beta-D-ribofuranosyl)purine is a potent antiviral compound used in the research of viral infections, particularly those caused by herpes viruses. It exhibits a high selectivity index and low toxicity towards host cells, making it an effective option for suppressing viral replication. This nucleoside analogue inhibits the viral DNA polymerase, thus preventing viral DNA research and development and subsequent viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 565450-78-4 |
| Pricing | Inquire |
| Cas | 565450-78-4 |
| Molecular Weight | 296.28 |
| Molecular Formula | C12H16N4O5 |
| Canonical SMILES | CC1(C(C(OC1N2C=NC3=C2N=CN=C3OC)CO)O)O |