Daidzein-[d4]
Daidzein-[d4], is the labelled analogue of Daidzein. Daidzein binds to estrogen receptor β but not ERα at concentrations up to 1 mM. And it is an inhibitor of carbonic anhydrase (CA) that is selective for carbonic CAVII and CAXII (Kis = 4.2 and 56 nM, respectively) over CAI, II, and IV (Kis = >10,000, >10,000, and 718.7 nM, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003511 |
| Pricing | Inquire |
| Cas | 1219803-57-2 |
| Molecular Weight | 258.26 |
| Molecular Formula | C15H6D4O4 |
| Canonical SMILES | C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3)O)O |