2-C-Methyl-4,5-O-(1-methylethylidene)-D-arabinonic Acid Ethyl Ester Cyclic Sulfate
2-C-Methyl-4,5-O-(1-methylethylidene)-D-arabinonic Acid Ethyl Ester Cyclic Sulfate can be utilized for the synthesis of2'-deoxy-2'-fluoro-2'-C-methylcytidine (I) (PSI-6130), which is a potent and selective inhibitor of HCV NS5B polymerase. It also has potential applications for the synthesis of related antiviral agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB056500 |
| Pricing | Inquire |
| Cas | 879551-01-6 |
| Molecular Weight | 310.32 |
| Molecular Formula | C11H18O8S |
| Canonical SMILES | CCOC(=O)C1(C(OS(=O)(=O)O1)C2COC(O2)(C)C)C |