7-O-Acetyl-N-acetylneuraminic acid
7-O-Acetyl-N-acetylneuraminic acid is a highly potent compound, showcasing remarkable efficacy in studying diverse viral infections owing to its profound antiviral properties. Furthermore, it assumes a pivotal role in the research and development of drugs targeting maladies induced by pathogenic entities like influenza viruses and sialylated bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | 18529-63-0 |
| Pricing | Inquire |
| Cas | 18529-63-0 |
| Molecular Weight | 351.31 |
| Molecular Formula | C13H21NO10 |
| Canonical SMILES | O=C(O)C(=O)CC(O)C(NC(=O)C)C(O)C(OC(=O)C)C(O)CO |